Benzyl-2,3,4,5,6-d5-dimethyldodecylammonium Bromide50mg
Benzyl-2,3,4,5,6-d5-dimethyldodecylammonium Bromide (CAS: 7281-04-1) has the chemical formula CH3(CH2)11N(Br)(CH3)2CH2C6D5 and a molecular weight of 388.25 g/mol It typically appears as white solid with a purity of 98 atom % D and a flash point of 110 °C commonly used in chemical synthesis or laboratory applications.
This content will be shared across all product pages.