Oleylamine, min. 95%5g
Oleylamine, min. 95% (CAS: 112-90-3) has the chemical formula CH3(CH2)7CHCH(CH2)7CH2NH2 and a molecular weight of 267.49 g/mol It typically appears as colorless liq. with a purity of min. 95% and a flash point of nan commonly used in chemical synthesis or laboratory applications.
This content will be shared across all product pages.